(2-FLUOROPHENYL)(4-METHOXY-3-NITROPHENYL)METHANONE structure
|
Common Name | (2-FLUOROPHENYL)(4-METHOXY-3-NITROPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 66938-39-4 | Molecular Weight | 275.23200 | |
| Density | 1.325g/cm3 | Boiling Point | 445.8ºC at 760 mmHg | |
| Molecular Formula | C14H10FNO4 | Melting Point | 133ºC | |
| MSDS | N/A | Flash Point | 223.4ºC | |
| Name | (2-fluorophenyl)-(4-methoxy-3-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 445.8ºC at 760 mmHg |
| Melting Point | 133ºC |
| Molecular Formula | C14H10FNO4 |
| Molecular Weight | 275.23200 |
| Flash Point | 223.4ºC |
| Exact Mass | 275.05900 |
| PSA | 72.12000 |
| LogP | 3.49670 |
| Index of Refraction | 1.581 |
| InChIKey | UVVKODTXMKKLNZ-UHFFFAOYSA-N |
| SMILES | COc1ccc(C(=O)c2ccccc2F)cc1[N+](=O)[O-] |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2914700090 |
|
~%
(2-FLUOROPHENYL... CAS#:66938-39-4 |
| Literature: Raeymackers; Van Gelder; Roevens; Janssen Arzneimittel-Forschung/Drug Research, 1978 , vol. 28, # 4 p. 586 - 594 |
|
~%
(2-FLUOROPHENYL... CAS#:66938-39-4 |
| Literature: Raeymackers; Van Gelder; Roevens; Janssen Arzneimittel-Forschung/Drug Research, 1978 , vol. 28, # 4 p. 586 - 594 |
|
~%
(2-FLUOROPHENYL... CAS#:66938-39-4 |
| Literature: Raeymackers; Van Gelder; Roevens; Janssen Arzneimittel-Forschung/Drug Research, 1978 , vol. 28, # 4 p. 586 - 594 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2-fluorophenyl 4-methoxy-3-nitrophenyl ketone |
| 2-Fluoro-4'-methoxy-3'-nitrobenzophenone |