(4-AMIDINOPHENYL)METHANESULFONYLFLUORIDE structure
|
Common Name | (4-AMIDINOPHENYL)METHANESULFONYLFLUORIDE | ||
|---|---|---|---|---|
| CAS Number | 66938-61-2 | Molecular Weight | 276.67500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C13H9ClN2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-amino-3-nitrophenyl)-(3-chlorophenyl)methanone |
|---|
| Molecular Formula | C13H9ClN2O3 |
|---|---|
| Molecular Weight | 276.67500 |
| Exact Mass | 276.03000 |
| PSA | 88.91000 |
| LogP | 4.16580 |
| InChIKey | SSLVPZCAZKCYMX-UHFFFAOYSA-N |
| SMILES | Nc1ccc(C(=O)c2cccc(Cl)c2)cc1[N+](=O)[O-] |
|
~76%
(4-AMIDINOPHENY... CAS#:66938-61-2 |
| Literature: Freyne; Raeymaekers; Venet; Sanz; Wouters; De Coster; Wauwe Bioorganic and medicinal chemistry letters, 1998 , vol. 8, # 3 p. 267 - 272 |
|
~%
(4-AMIDINOPHENY... CAS#:66938-61-2 |
| Literature: Freyne; Raeymaekers; Venet; Sanz; Wouters; De Coster; Wauwe Bioorganic and medicinal chemistry letters, 1998 , vol. 8, # 3 p. 267 - 272 |
|
~%
(4-AMIDINOPHENY... CAS#:66938-61-2 |
| Literature: Freyne; Raeymaekers; Venet; Sanz; Wouters; De Coster; Wauwe Bioorganic and medicinal chemistry letters, 1998 , vol. 8, # 3 p. 267 - 272 |
|
~%
(4-AMIDINOPHENY... CAS#:66938-61-2 |
| Literature: Freyne; Raeymaekers; Venet; Sanz; Wouters; De Coster; Wauwe Bioorganic and medicinal chemistry letters, 1998 , vol. 8, # 3 p. 267 - 272 |