BEDT-TTF structure
|
Common Name | BEDT-TTF | ||
|---|---|---|---|---|
| CAS Number | 66946-48-3 | Molecular Weight | 384.690 | |
| Density | 1.8±0.1 g/cm3 | Boiling Point | 497.4±45.0 °C at 760 mmHg | |
| Molecular Formula | C10H8S8 | Melting Point | ~260 °C (dec.)(lit.) | |
| MSDS | Chinese USA | Flash Point | 268.4±25.8 °C | |
| Name | Bis(ethylenedithiolo)tetrathiafulvalene |
|---|---|
| Synonym | More Synonyms |
| Density | 1.8±0.1 g/cm3 |
|---|---|
| Boiling Point | 497.4±45.0 °C at 760 mmHg |
| Melting Point | ~260 °C (dec.)(lit.) |
| Molecular Formula | C10H8S8 |
| Molecular Weight | 384.690 |
| Flash Point | 268.4±25.8 °C |
| Exact Mass | 383.839172 |
| PSA | 202.40000 |
| LogP | 6.51 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.966 |
| InChIKey | LZJCVNLYDXCIBG-UHFFFAOYSA-N |
| SMILES | C1CSC2=C(S1)SC(=C1SC3=C(SCCS3)S1)S2 |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Safety Phrases | S22-S24/25 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2934999090 |
| HS Code | 2934999090 |
|---|---|
| Summary | 2934999090. other heterocyclic compounds. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
|
Radical-cation salts of BEDT-TTF with lithium tris(oxalato)metallate(III).
Dalton Trans. 44(13) , 6219-23, (2015) The first radical-cation salts in the extensive family (BEDT-TTF)x[(A)M(C2O4)3]·Guest containing lithium as the counter cation have been synthesized and characterised. |
|
|
Aldrichimica Acta 23 , 54, (1990)
|
| 2-(5,6-Dihydro[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,6-dihydro[1,3]dithiolo[4,5-b][1,4]dithiine |
| 2-(5,6-Dihydro-1,3-dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,6-dihydro-1,3-dithiolo[4,5-b][1,4]dithiin |
| MFCD00059710 |
| 2-(5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,6-dihydro-[1,3]dithiolo[4,5-b][1,4]dithiine |
| BEDT-TTF |
| Bis(ethylenedithia)tetrathiafulvalene |
| 1,3-Dithiolo[4,5-b][1,4]dithiin, 2-(5,6-dihydro-1,3-dithiolo[4,5-b][1,4]dithiin-2-ylidene)-5,6-dihydro- |