3-fluoro-4-phenylpropiophenone
Modify Date: 2026-07-08 12:32:30
3-fluoro-4-phenylpropiophenone structure
|
Common Name | 3-fluoro-4-phenylpropiophenone | ||
|---|---|---|---|---|
| CAS Number | 66952-43-0 | Molecular Weight | 228.26200 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C15H13FO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-fluoro-4-phenylpropiophenone |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C15H13FO |
|---|---|
| Molecular Weight | 228.26200 |
| Exact Mass | 228.09500 |
| PSA | 17.07000 |
| LogP | 4.08540 |
| InChIKey | XAURACZKHYGYKC-UHFFFAOYSA-N |
| SMILES | CCC(=O)c1ccc(-c2ccccc2)c(F)c1 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:5104-49-4This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3-fluoro-4-phenylpropiophenone? |
| A: The English name of 3-fluoro-4-phenylpropiophenone is 3-fluoro-4-phenylpropiophenone. |
| Q: What are the downstream products of 3-fluoro-4-phenylpropiophenone? |
| A: Related downstream products(CAS) of 3-fluoro-4-phenylpropiophenone: 5104-49-4. |
| Q: What is the SMILES notation of 3-fluoro-4-phenylpropiophenone? |
| A: SMILES notation of 3-fluoro-4-phenylpropiophenone is CCC(=O)c1ccc(-c2ccccc2)c(F)c1. |
| Q: What is the CAS number of 3-fluoro-4-phenylpropiophenone? |
| A: CAS number of 3-fluoro-4-phenylpropiophenone is 66952-43-0. |
| Q: What is the polar surface area (PSA) of 3-fluoro-4-phenylpropiophenone? |
| A: Polar surface area (PSA) of 3-fluoro-4-phenylpropiophenone is 17.07000. |
| Q: What is the molecular weight of 3-fluoro-4-phenylpropiophenone? |
| A: Molecular weight of 3-fluoro-4-phenylpropiophenone is 228.26200. |
| Q: What is the InChIKey of 3-fluoro-4-phenylpropiophenone? |
| A: InChIKey of 3-fluoro-4-phenylpropiophenone is XAURACZKHYGYKC-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 66952-43-0? |
| A: Chinese name of 66952-43-0 is 66952-43-0. |
| Q: What is the molecular formula of 3-fluoro-4-phenylpropiophenone? |
| A: Molecular formula of 3-fluoro-4-phenylpropiophenone is C15H13FO. |
| Q: What is the LogP of 3-fluoro-4-phenylpropiophenone? |
| A: LogP of 3-fluoro-4-phenylpropiophenone is 4.08540. |