Benzyl-PEG9-THP structure
|
Common Name | Benzyl-PEG9-THP | ||
|---|---|---|---|---|
| CAS Number | 669556-53-0 | Molecular Weight | 588.72700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C30H52O11 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of Benzyl-PEG9-THPBenzyl-PEG9-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
| Name | 2-((1-phenyl-2,5,8,11,14,17,20,23,26-nonaoxaoctacosan-28-yl)oxy)tetrahydro-2H-pyran |
|---|---|
| Synonym | More Synonyms |
| Description | Benzyl-PEG9-THP is a PEG-based PROTAC linker that can be used in the synthesis of PROTACs[1]. |
|---|---|
| Related Catalog | |
| Target |
PEGs |
| In Vitro | PROTACs contain two different ligands connected by a linker; one is a ligand for an E3 ubiquitin ligase and the other is for the target protein. PROTACs exploit the intracellular ubiquitin-proteasome system to selectively degrade target proteins[1]. |
| References |
| Molecular Formula | C30H52O11 |
|---|---|
| Molecular Weight | 588.72700 |
| Exact Mass | 588.35100 |
| PSA | 101.53000 |
| LogP | 2.87920 |
| InChIKey | UPOGSHHHOLZUFV-UHFFFAOYSA-N |
| SMILES | c1ccc(COCCOCCOCCOCCOCCOCCOCCOCCOCCOC2CCCCO2)cc1 |
| Precursor 0 | |
|---|---|
| DownStream 2 | |
| Benzyl-PEG9-THP |