3-BIPHENYL-[1,3]DIOXOL-5-YL-ACETICACID structure
|
Common Name | 3-BIPHENYL-[1,3]DIOXOL-5-YL-ACETICACID | ||
|---|---|---|---|---|
| CAS Number | 669713-75-1 | Molecular Weight | 256.25300 | |
| Density | 1.325g/cm3 | Boiling Point | 445.4ºC at 760 mmHg | |
| Molecular Formula | C15H12O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 171.5ºC | |
| Name | 2-[3-(1,3-benzodioxol-5-yl)phenyl]acetic acid |
|---|
| Density | 1.325g/cm3 |
|---|---|
| Boiling Point | 445.4ºC at 760 mmHg |
| Molecular Formula | C15H12O4 |
| Molecular Weight | 256.25300 |
| Flash Point | 171.5ºC |
| Exact Mass | 256.07400 |
| PSA | 55.76000 |
| LogP | 2.70940 |
| Index of Refraction | 1.622 |
| InChIKey | HDZYSLBSWPPUJY-UHFFFAOYSA-N |
| SMILES | O=C(O)Cc1cccc(-c2ccc3c(c2)OCO3)c1 |
| HS Code | 2932999099 |
|---|
| HS Code | 2932999099 |
|---|---|
| Summary | 2932999099. other heterocyclic compounds with oxygen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |