ART-CHEM-BB B018031
Modify Date: 2025-08-20 21:32:29
ART-CHEM-BB B018031 structure
|
Common Name | ART-CHEM-BB B018031 | ||
|---|---|---|---|---|
| CAS Number | 669729-26-4 | Molecular Weight | 259.37000 | |
| Density | 1.14g/cm3 | Boiling Point | 337.3ºC at 760 mmHg | |
| Molecular Formula | C14H17N3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.8ºC | |
| Name | 3-(4-propan-2-ylphenyl)-4-prop-2-enyl-1H-1,2,4-triazole-5-thione |
|---|
| Density | 1.14g/cm3 |
|---|---|
| Boiling Point | 337.3ºC at 760 mmHg |
| Molecular Formula | C14H17N3S |
| Molecular Weight | 259.37000 |
| Flash Point | 157.8ºC |
| Exact Mass | 259.11400 |
| PSA | 69.51000 |
| LogP | 3.54320 |
| Index of Refraction | 1.61 |
| InChIKey | PNTLJYXWEGOQAV-UHFFFAOYSA-N |
| SMILES | C=CCn1c(-c2ccc(C(C)C)cc2)n[nH]c1=S |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |