5-[4-(DIETHYLAMINO)PHENYL]-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL structure
|
Common Name | 5-[4-(DIETHYLAMINO)PHENYL]-4-METHYL-4H-1,2,4-TRIAZOLE-3-THIOL | ||
|---|---|---|---|---|
| CAS Number | 669748-04-3 | Molecular Weight | 262.37400 | |
| Density | 1.18g/cm3 | Boiling Point | 366.2ºC at 760 mmHg | |
| Molecular Formula | C13H18N4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 175.3ºC | |
| Name | 3-[4-(diethylamino)phenyl]-4-methyl-1H-1,2,4-triazole-5-thione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.18g/cm3 |
|---|---|
| Boiling Point | 366.2ºC at 760 mmHg |
| Molecular Formula | C13H18N4S |
| Molecular Weight | 262.37400 |
| Flash Point | 175.3ºC |
| Exact Mass | 262.12500 |
| PSA | 72.75000 |
| LogP | 2.61700 |
| Index of Refraction | 1.621 |
| InChIKey | JGUIIWYUQLNIRQ-UHFFFAOYSA-N |
| SMILES | CCN(CC)c1ccc(-c2n[nH]c(=S)n2C)cc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-[4-(diethylamino)phenyl]-4-methyl-1,2,4-triazole-3-thiol |
| 5-[4-(diethylamino)phenyl]-4-methyl-4H-1,2,4-triazole-3-thiol |