2-(diethylamino)ethyl 2-chloro-2,2-diphenylacetate structure
|
Common Name | 2-(diethylamino)ethyl 2-chloro-2,2-diphenylacetate | ||
|---|---|---|---|---|
| CAS Number | 6699-38-3 | Molecular Weight | 345.86300 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C20H24ClNO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 2-(diethylamino)ethyl 2-chloro-2,2-diphenylacetate |
|---|
| Molecular Formula | C20H24ClNO2 |
|---|---|
| Molecular Weight | 345.86300 |
| Exact Mass | 345.15000 |
| PSA | 29.54000 |
| LogP | 4.05400 |
| InChIKey | ZASSLOPXOOJHFR-UHFFFAOYSA-N |
| SMILES | CCN(CC)CCOC(=O)C(Cl)(c1ccccc1)c1ccccc1 |
| HS Code | 2922199090 |
|---|
|
~%
2-(diethylamino... CAS#:6699-38-3 |
| Literature: Blicke et al. Journal of the American Chemical Society, 1954 , vol. 76, p. 3161 |
|
~%
2-(diethylamino... CAS#:6699-38-3 |
| Literature: Protiva; Vejdelek Collection of Czechoslovak Chemical Communications, 1950 , vol. 15, p. 541,549 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |
| HS Code | 2922199090 |
|---|---|
| Summary | 2922199090. other amino-alcohols, other than those containing more than one kind of oxygen function, their ethers and esters; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |