2-chloro-2,2-diphenylacetyl chloride structure
|
Common Name | 2-chloro-2,2-diphenylacetyl chloride | ||
|---|---|---|---|---|
| CAS Number | 2902-98-9 | Molecular Weight | 265.13500 | |
| Density | 1.286 g/cm3 | Boiling Point | 193ºC27 mm Hg(lit.) | |
| Molecular Formula | C14H10Cl2O | Melting Point | 48-50ºC(lit.) | |
| MSDS | Chinese USA | Flash Point | 113ºC | |
| Symbol |
GHS05, GHS07 |
Signal Word | Danger | |
| Name | 2-chloro-2,2-diphenylacetyl chloride |
|---|---|
| Synonym | More Synonyms |
| Density | 1.286 g/cm3 |
|---|---|
| Boiling Point | 193ºC27 mm Hg(lit.) |
| Melting Point | 48-50ºC(lit.) |
| Molecular Formula | C14H10Cl2O |
| Molecular Weight | 265.13500 |
| Flash Point | 113ºC |
| Exact Mass | 264.01100 |
| PSA | 17.07000 |
| LogP | 3.93440 |
| Vapour Pressure | 0.000562mmHg at 25°C |
| Index of Refraction | 1.589 |
| InChIKey | NFHKZAUDRWRXMZ-UHFFFAOYSA-N |
| SMILES | O=C(Cl)C(Cl)(c1ccccc1)c1ccccc1 |
| Storage condition | 2-8℃ |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS05, GHS07 |
|---|---|
| Signal Word | Danger |
| Hazard Statements | H314-H335 |
| Precautionary Statements | P261-P280-P305 + P351 + P338-P310 |
| Personal Protective Equipment | Eyeshields;Faceshields;full-face particle respirator type N100 (US);Gloves;respirator cartridge type N100 (US);type P1 (EN143) respirator filter;type P3 (EN 143) respirator cartridges |
| Hazard Codes | C: Corrosive; |
| Risk Phrases | R34 |
| Safety Phrases | 26-27-28-36/37/39-45 |
| RIDADR | UN 3261 |
| RTECS | AO6490000 |
| Packaging Group | III |
| HS Code | 2916399090 |
| Precursor 8 | |
|---|---|
| DownStream 9 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| Chlor-diphenyl-acetylchlorid |
| MFCD00000815 |
| Diphenylchloroacetylchloride |
| EINECS 220-798-6 |
| diphenylchloroacetic acid chloride |
| 2-chloro-2,2-diphenylacetylchloride |
| ACETYL CHLORIDE,CHLORODIPHENYL |
| Chlorodiphenylacetyl chloride |