1,3-Bis(vinylsulfonyl)-2-propanol structure
|
Common Name | 1,3-Bis(vinylsulfonyl)-2-propanol | ||
|---|---|---|---|---|
| CAS Number | 67006-32-0 | Molecular Weight | 240.297 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 554.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C7H12O5S2 | Melting Point | 96°C | |
| MSDS | N/A | Flash Point | 289.3±28.7 °C | |
| Name | 1,3-Bis(vinylsulfonyl)-2-propanol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 554.7±45.0 °C at 760 mmHg |
| Melting Point | 96°C |
| Molecular Formula | C7H12O5S2 |
| Molecular Weight | 240.297 |
| Flash Point | 289.3±28.7 °C |
| Exact Mass | 240.012619 |
| PSA | 105.27000 |
| LogP | -0.54 |
| Vapour Pressure | 0.0±3.4 mmHg at 25°C |
| Index of Refraction | 1.522 |
| InChIKey | SOBDFTUDYRPGJY-UHFFFAOYSA-N |
| SMILES | C=CS(=O)(=O)CC(O)CS(=O)(=O)C=C |
| Risk Phrases | R36/37/38:Irritating to eyes, respiratory system and skin . |
|---|---|
| Safety Phrases | S26-S36/37/39 |
| 2-Propanol, 1,3-bis(ethenylsulfonyl)- |
| MFCD00671498 |
| 1,3-bis(vinylsulfonyl)propan-2-ol |
| Bis(vinylsulfonyl)propanol |
| 1,3-Bis(vinylsulfonyl)-2-propanol |