2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid structure
|
Common Name | 2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid | ||
|---|---|---|---|---|
| CAS Number | 67010-09-7 | Molecular Weight | 276.28800 | |
| Density | 1.321g/cm3 | Boiling Point | 608.8ºC at 760 mmHg | |
| Molecular Formula | C14H16N2O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 322ºC | |
| Name | 2-acetamido-3-(5-methoxy-1H-indol-3-yl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1.321g/cm3 |
|---|---|
| Boiling Point | 608.8ºC at 760 mmHg |
| Molecular Formula | C14H16N2O4 |
| Molecular Weight | 276.28800 |
| Flash Point | 322ºC |
| Exact Mass | 276.11100 |
| PSA | 91.42000 |
| LogP | 1.69920 |
| Index of Refraction | 1.623 |
| InChIKey | IJODSTPSSWJSBC-ZDUSSCGKSA-N |
| SMILES | COc1ccc2[nH]cc(CC(NC(C)=O)C(=O)O)c2c1 |
| HS Code | 2933990090 |
|---|
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 5-methoxy-Nb-acetyl-L-tryptophan |
| 2-(acetylamino)-3-(5-methoxy-1H-indol-3-yl)propanoic acid |
| AmbotzAAA1951 |
| A-1476 |