(4-METHYLPIPERAZIN-1-YL)(2-NITROPHENYL)METHANONE structure
|
Common Name | (4-METHYLPIPERAZIN-1-YL)(2-NITROPHENYL)METHANONE | ||
|---|---|---|---|---|
| CAS Number | 67023-01-2 | Molecular Weight | 249.26600 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C12H15N3O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | (4-methylpiperazin-1-yl)-(2-nitrophenyl)methanone |
|---|---|
| Synonym | More Synonyms |
| Molecular Formula | C12H15N3O3 |
|---|---|
| Molecular Weight | 249.26600 |
| Exact Mass | 249.11100 |
| PSA | 69.37000 |
| LogP | 1.38140 |
| InChIKey | YRQBFQMVTVLQGD-UHFFFAOYSA-N |
| SMILES | CN1CCN(C(=O)c2ccccc2[N+](=O)[O-])CC1 |
| HS Code | 2933599090 |
|---|
|
~89%
(4-METHYLPIPERA... CAS#:67023-01-2 |
| Literature: Cervena, Irena; Protiva, Miroslav Collection of Czechoslovak Chemical Communications, 1984 , vol. 49, # 4 p. 1009 - 1020 |
| Precursor 2 | |
|---|---|
| DownStream 1 | |
| HS Code | 2933599090 |
|---|---|
| Summary | 2933599090. other compounds containing a pyrimidine ring (whether or not hydrogenated) or piperazine ring in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-methylpiperazinyl 2-nitrophenyl ketone |