1-Cyano-3-(2,6-dimethylphenyl)-2-(2-methyl-2-propanyl)guanidine structure
|
Common Name | 1-Cyano-3-(2,6-dimethylphenyl)-2-(2-methyl-2-propanyl)guanidine | ||
|---|---|---|---|---|
| CAS Number | 67026-94-2 | Molecular Weight | 244.33500 | |
| Density | 1.01g/cm3 | Boiling Point | 336.6ºC at 760 mmHg | |
| Molecular Formula | C14H20N4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 157.4ºC | |
| Name | 1-Cyano-3-(2,6-dimethylphenyl)-2-(2-methyl-2-propanyl)guanidine |
|---|
| Density | 1.01g/cm3 |
|---|---|
| Boiling Point | 336.6ºC at 760 mmHg |
| Molecular Formula | C14H20N4 |
| Molecular Weight | 244.33500 |
| Flash Point | 157.4ºC |
| Exact Mass | 244.16900 |
| PSA | 60.21000 |
| LogP | 3.40438 |
| Index of Refraction | 1.535 |
| InChIKey | GGRLOLARDKIMDE-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1NC(=NC(C)(C)C)NC#N |
|
~%
1-Cyano-3-(2,6-... CAS#:67026-94-2 |
| Literature: Petersen,H.J. et al. Journal of Medicinal Chemistry, 1978 , vol. 21, p. 773 - 781 |