5-Isopentyl-5-vinylbarbituric acid structure
|
Common Name | 5-Isopentyl-5-vinylbarbituric acid | ||
|---|---|---|---|---|
| CAS Number | 67051-34-7 | Molecular Weight | 224.25600 | |
| Density | 1.151g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C11H16N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 5-ethenyl-5-(3-methylbutyl)-1,3-diazinane-2,4,6-trione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.151g/cm3 |
|---|---|
| Molecular Formula | C11H16N2O3 |
| Molecular Weight | 224.25600 |
| Exact Mass | 224.11600 |
| PSA | 82.25000 |
| LogP | 1.51280 |
| Index of Refraction | 1.522 |
| InChIKey | JYKMNZIAWVDMDX-UHFFFAOYSA-N |
| SMILES | C=CC1(CCC(C)C)C(=O)NC(=O)NC1=O |
|
~%
5-Isopentyl-5-v... CAS#:67051-34-7 |
| Literature: Heyl; Cope Journal of the American Chemical Society, 1943 , vol. 65, p. 671 |
|
~%
5-Isopentyl-5-v... CAS#:67051-34-7 |
| Literature: Heyl; Cope Journal of the American Chemical Society, 1943 , vol. 65, p. 671 |
| 2,4,6-trione |