Diethyl (3-methylbutyl)malonate structure
|
Common Name | Diethyl (3-methylbutyl)malonate | ||
|---|---|---|---|---|
| CAS Number | 5398-08-3 | Molecular Weight | 230.301 | |
| Density | 1.0±0.1 g/cm3 | Boiling Point | 241.0±0.0 °C at 760 mmHg | |
| Molecular Formula | C12H22O4 | Melting Point | 6ºC | |
| MSDS | N/A | Flash Point | 109.8±16.9 °C | |
| Name | diethyl 2-(3-methylbutyl)propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.0±0.1 g/cm3 |
|---|---|
| Boiling Point | 241.0±0.0 °C at 760 mmHg |
| Melting Point | 6ºC |
| Molecular Formula | C12H22O4 |
| Molecular Weight | 230.301 |
| Flash Point | 109.8±16.9 °C |
| Exact Mass | 230.151810 |
| PSA | 52.60000 |
| LogP | 2.99 |
| Vapour Pressure | 0.0±0.4 mmHg at 25°C |
| Index of Refraction | 1.435 |
| InChIKey | MPJCIHOJXMCSIM-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(CCC(C)C)C(=O)OCC |
| Safety Phrases | S23-S24/25 |
|---|---|
| HS Code | 2917190090 |
| Precursor 10 | |
|---|---|
| DownStream 10 | |
| HS Code | 2917190090 |
|---|---|
| Summary | 2917190090 acyclic polycarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| Diethyl 2-isopentylmalonate |
| ethyl 2-isopentylmalonate |
| Diethyl isopentylmalonate |
| DIETHYL ISOAMYLMALONATE |
| Diethyl (3-methylbutyl)malonate |
| Isopentylmalonsaeurediethylester |
| ZLC0230 |
| Propanedioic acid, 2-(3-methylbutyl)-, diethyl ester |
| methyl-3 butylmalonate de diethyle |
| EINECS 226-424-8 |
| MFCD00026872 |