2,2,5,5-tetrakis(chloromethyl)cyclopentan-1-one structure
|
Common Name | 2,2,5,5-tetrakis(chloromethyl)cyclopentan-1-one | ||
|---|---|---|---|---|
| CAS Number | 67059-01-2 | Molecular Weight | 278.00300 | |
| Density | 1.312g/cm3 | Boiling Point | 383.3ºC at 760 mmHg | |
| Molecular Formula | C9H12Cl4O | Melting Point | 71.5-74.5ºC(lit.) | |
| MSDS | USA | Flash Point | 162.1ºC | |
| Name | 2,2,5,5-tetrakis(chloromethyl)cyclopentan-1-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.312g/cm3 |
|---|---|
| Boiling Point | 383.3ºC at 760 mmHg |
| Melting Point | 71.5-74.5ºC(lit.) |
| Molecular Formula | C9H12Cl4O |
| Molecular Weight | 278.00300 |
| Flash Point | 162.1ºC |
| Exact Mass | 275.96400 |
| PSA | 17.07000 |
| LogP | 3.27730 |
| Index of Refraction | 1.489 |
| InChIKey | OPNWCHGGNNYGDZ-UHFFFAOYSA-N |
| SMILES | O=C1C(CCl)(CCl)CCC1(CCl)CCl |
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | C |
| Risk Phrases | R34 |
| Safety Phrases | S26;S45;S36/S37/S39 |
| RIDADR | NONH for all modes of transport |
| HS Code | 2914700090 |
|
~%
2,2,5,5-tetraki... CAS#:67059-01-2 |
| Literature: Chemicke Zvesti, , vol. 11, p. 703,705 Chem.Abstr., , p. 9969 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
| 2,2,4-TRIMETHYLPENTANE ASTM |
| 2,2,5,5-Tetrakis-chlormethyl-cyclopentanon |