1-[4-(4-Chlorophenyl)-2-hydroxylbutyl]imidazole structure
|
Common Name | 1-[4-(4-Chlorophenyl)-2-hydroxylbutyl]imidazole | ||
|---|---|---|---|---|
| CAS Number | 67085-11-4 | Molecular Weight | 250.724 | |
| Density | 1.2±0.1 g/cm3 | Boiling Point | 472.2±40.0 °C at 760 mmHg | |
| Molecular Formula | C13H15ClN2O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.4±27.3 °C | |
| Name | 4-(4-chlorophenyl)-1-imidazol-1-ylbutan-2-ol |
|---|---|
| Synonym | More Synonyms |
| Density | 1.2±0.1 g/cm3 |
|---|---|
| Boiling Point | 472.2±40.0 °C at 760 mmHg |
| Molecular Formula | C13H15ClN2O |
| Molecular Weight | 250.724 |
| Flash Point | 239.4±27.3 °C |
| Exact Mass | 250.087296 |
| PSA | 38.05000 |
| LogP | 2.48 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.590 |
| InChIKey | YAHZVMVZBIMHGM-UHFFFAOYSA-N |
| SMILES | OC(CCc1ccc(Cl)cc1)Cn1ccnc1 |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933290090 |
|
~83%
1-[4-(4-Chlorop... CAS#:67085-11-4 |
| Literature: RICHTER GEDEON VEGYESZETI GYAR RT. Patent: WO2005/70897 A1, 2005 ; Location in patent: Page/Page column 7 ; |
|
~%
1-[4-(4-Chlorop... CAS#:67085-11-4 |
| Literature: Bioorganic and Medicinal Chemistry, , vol. 15, # 9 p. 3225 - 3234 |
| HS Code | 2933290090 |
|---|---|
| Summary | 2933290090. other compounds containing an unfused imidazole ring (whether or not hydrogenated) in the structure. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| Butoconazole nitrate Intermediate |
| 1-[4-(4-Chlorophenyl)-2-hydroxylbutyl]imidazole |
| 1-[2-hydroxy-4-(4-chlorophenyl)-n-butyl]imidazole |
| 1H-Imidazole-1-ethanol, α-[2-(4-chlorophenyl)ethyl]- |
| 1-(4-(4-chlorophenyl)-2-hydroxybutyl)-imidazole |
| 4-(4-Chlorophenyl)-1-(1H-imidazol-1-yl)butan-2-ol |
| 4-(4-Chlorophenyl)-1-(1H-imidazol-1-yl)-2-butanol |
| 1-[4-(4-chlorophenyl)-2-hydroxy-n-butyl]-imidazole |
| AC-6277 |
| 1-[4-(4-Chlorophenyl)-2-hydroxybutyl]-1H-imidazole |
| T5N CNJ A1YQ2R DG |
| 4-(4-chloro-phenyl)-1-imidazol-1-yl-butan-2-ol |
| α-[2-(4-Chlorophenyl)ethyl]-1H-imidazole-1-ethanol |