Tubotaiwine
Modify Date: 2025-09-15 19:59:57
Tubotaiwine structure
|
Common Name | Tubotaiwine | ||
|---|---|---|---|---|
| CAS Number | 6711-69-9 | Molecular Weight | 324.417 | |
| Density | 1.3±0.1 g/cm3 | Boiling Point | 467.7±45.0 °C at 760 mmHg | |
| Molecular Formula | C20H24N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 236.6±28.7 °C | |
| Name | Tubotaiwin |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3±0.1 g/cm3 |
|---|---|
| Boiling Point | 467.7±45.0 °C at 760 mmHg |
| Molecular Formula | C20H24N2O2 |
| Molecular Weight | 324.417 |
| Flash Point | 236.6±28.7 °C |
| Exact Mass | 324.183777 |
| PSA | 41.57000 |
| LogP | 3.37 |
| Vapour Pressure | 0.0±1.2 mmHg at 25°C |
| Index of Refraction | 1.639 |
| InChIKey | RLAKWLFUMAABBE-STJTYLQHSA-N |
| SMILES | CCC1C2CCN3CCC4(C(=C2C(=O)OC)Nc2ccccc24)C13 |
| Hazard Codes | Xi |
|---|
|
Name: Inhibition of COX-2 (unknown origin) using arachidonic acid as substrate at 100 uM pr...
Source: ChEMBL
Target: Prostaglandin G/H synthase 2
External Id: CHEMBL5121291
|
|
Name: Inhibition of 5-LOX (unknown origin) using arachidonic acid as substrate at 100 uM pr...
Source: ChEMBL
Target: Polyunsaturated fatty acid 5-lipoxygenase
External Id: CHEMBL5121292
|
|
Name: Antileishmanial activity against Leishmania infantum PB75 assessed as cell growth inh...
Source: ChEMBL
Target: Leishmania infantum
External Id: CHEMBL5121293
|
|
Name: Antimycobacterial activity against Mycobacterium tuberculosis H37Rv ATCC 27294 assess...
Source: ChEMBL
Target: Mycobacterium tuberculosis
External Id: CHEMBL5121294
|
|
Name: Inhibition of COX-1 (unknown origin) using arachidonic acid as substrate at 100 uM pr...
Source: ChEMBL
Target: Prostaglandin G/H synthase 1
External Id: CHEMBL5121290
|
|
Name: Inhibition of electric eel AChE
Source: ChEMBL
Target: Acetylcholinesterase
External Id: CHEMBL1027594
|
|
Name: Cytotoxicity against human MCF7 cells after 72 hrs by sulforhodamine B assay
Source: ChEMBL
Target: MCF7
External Id: CHEMBL4201291
|
|
Name: Cytotoxicity against human A549 cells after 72 hrs by sulforhodamine B assay
Source: ChEMBL
Target: A549
External Id: CHEMBL4201292
|
Total 8, Current Page 1 of 1
1
| 3,5-Ethano-3H-pyrrolo[2,3-d]carbazole-6-carboxylic acid, 4-ethyl-1,2,3a,4,5,7-hexahydro-, methyl ester |
| Methyl 18-ethyl-8,14-diazapentacyclo[9.5.2.0.0.0]octadeca-2,4,6,9-tetraene-10-carboxylate |