3-methylcrotonyl-CoA
3-methylcrotonyl-CoA structure
|
Common Name | 3-methylcrotonyl-CoA | ||
|---|---|---|---|---|
| CAS Number | 6712-03-4 | Molecular Weight | 849.63500 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C26H42N7O17P3S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3-methylcrotonyl-CoA |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C26H42N7O17P3S |
|---|---|
| Molecular Weight | 849.63500 |
| Exact Mass | 849.15700 |
| PSA | 418.36000 |
| LogP | 0.99390 |
| InChIKey | BXIPALATIYNHJN-ZMHDXICWSA-N |
| SMILES | CC(C)=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:33008-07-0
CAS#:85-61-0![5-[2-[3-[[4-[[[5-(6-aminopurin-9-yl)-4-hydroxy-3-phosphonooxyoxolan-2-yl]methoxy-hydroxyphosphoryl]oxy-hydroxyphosphoryl]oxy-2-hydroxy-3,3-dimethylbutanoyl]amino]propanoylamino]ethylsulfanyl]-3-methyl-5-oxopent-3-enoic acid structure](https://image.chemsrc.com/caspic/205/6247-73-0.png)
CAS#:6247-73-0This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 2-methyl-3-butenoyl-CoA |
| S-(3-Methyl-crotonoyl)-coenzym-A |
| S-(3-methyl-crotonoyl)-coenzyme-A |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the downstream products of 3-methylcrotonyl-CoA? |
| A: Related downstream products(CAS) of 3-methylcrotonyl-CoA: 33008-07-0;85-61-0;6247-73-0. |
| Q: What English synonyms does 3-methylcrotonyl-CoA have? |
| A: English synonyms of 3-methylcrotonyl-CoA: 2-methyl-3-butenoyl-CoA, S-(3-Methyl-crotonoyl)-coenzym-A, S-(3-methyl-crotonoyl)-coenzyme-A. |
| Q: What is the molecular formula of 3-methylcrotonyl-CoA? |
| A: Molecular formula of 3-methylcrotonyl-CoA is C26H42N7O17P3S. |
| Q: What is the molecular weight of 3-methylcrotonyl-CoA? |
| A: Molecular weight of 3-methylcrotonyl-CoA is 849.63500. |
| Q: What is the English name of 3-methylcrotonyl-CoA? |
| A: The English name of 3-methylcrotonyl-CoA is 3-methylcrotonyl-CoA. |
| Q: What is the SMILES notation of 3-methylcrotonyl-CoA? |
| A: SMILES notation of 3-methylcrotonyl-CoA is CC(C)=CC(=O)SCCNC(=O)CCNC(=O)C(O)C(C)(C)COP(=O)(O)OP(=O)(O)OCC1OC(n2cnc3c(N)ncnc32)C(O)C1OP(=O)(O)O. |
| Q: What is the LogP of 3-methylcrotonyl-CoA? |
| A: LogP of 3-methylcrotonyl-CoA is 0.99390. |
| Q: What is the CAS number of 3-methylcrotonyl-CoA? |
| A: CAS number of 3-methylcrotonyl-CoA is 6712-03-4. |
| Q: What is the Chinese name of 6712-03-4? |
| A: Chinese name of 6712-03-4 is 6712-03-4. |
| Q: What is the InChIKey of 3-methylcrotonyl-CoA? |
| A: InChIKey of 3-methylcrotonyl-CoA is BXIPALATIYNHJN-ZMHDXICWSA-N. |