Metazachlor structure
|
Common Name | Metazachlor | ||
|---|---|---|---|---|
| CAS Number | 67129-08-2 | Molecular Weight | 277.74900 | |
| Density | 1.19 g/cm3 | Boiling Point | 439.2ºC at 760 mmHg | |
| Molecular Formula | C14H16ClN3O | Melting Point | 74-78°C | |
| MSDS | Chinese USA | Flash Point | 2 °C | |
| Symbol |
GHS07, GHS08, GHS09 |
Signal Word | Warning | |
Use of MetazachlorMetazachlor is a herbicide of the chloroacetamide class. Metazachlor is an inhibitor of the synthesis of long chain fatty acids and has an effect on cell division or tissue differentiation in the germinating and emerging weed target species[1]. |
| Name | metazachlor |
|---|---|
| Synonym | More Synonyms |
| Description | Metazachlor is a herbicide of the chloroacetamide class. Metazachlor is an inhibitor of the synthesis of long chain fatty acids and has an effect on cell division or tissue differentiation in the germinating and emerging weed target species[1]. |
|---|---|
| Related Catalog | |
| Target |
IC50: synthesis of long chain fatty acids[1] |
| References |
| Density | 1.19 g/cm3 |
|---|---|
| Boiling Point | 439.2ºC at 760 mmHg |
| Melting Point | 74-78°C |
| Molecular Formula | C14H16ClN3O |
| Molecular Weight | 277.74900 |
| Flash Point | 2 °C |
| Exact Mass | 277.09800 |
| PSA | 38.13000 |
| LogP | 2.72940 |
| Index of Refraction | 1.586 |
| InChIKey | STEPQTYSZVCJPV-UHFFFAOYSA-N |
| SMILES | Cc1cccc(C)c1N(Cn1cccn1)C(=O)CCl |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Symbol |
GHS07, GHS08, GHS09 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H351-H410 |
| Precautionary Statements | P273-P301 + P312 + P330-P391-P501 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R22 |
| Safety Phrases | S36-S26-S16 |
| RIDADR | UN 1648 3/PG 2 |
| RTECS | AB5442000 |
|
~%
Metazachlor CAS#:67129-08-2 |
| Literature: WO2013/104478 A1, ; Page/Page column 18 ; |
| bas479h |
| Metazachlor |
| Pree |
| MFCD00055509 |
| EINECS 266-583-0 |
| 2-chloro-N-(pyrazol-1-ylmethyl)acet-2’,6’-xylidide |
| 2-chloro-N-(2,6-dimethylphenyl)-N-(1H-pyrazol-1-ylmethyl)acetamide |
| BUTISAN S |
| Butisan |
| Track |