3,3-dimethyl-6-nitro-indan-1-one
3,3-dimethyl-6-nitro-indan-1-one structure
|
Common Name | 3,3-dimethyl-6-nitro-indan-1-one | ||
|---|---|---|---|---|
| CAS Number | 67159-79-9 | Molecular Weight | 205.21000 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C11H11NO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3-dimethyl-6-nitro-indan-1-one |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C11H11NO3 |
|---|---|
| Molecular Weight | 205.21000 |
| Exact Mass | 205.07400 |
| PSA | 62.89000 |
| LogP | 2.98200 |
| InChIKey | QPCPKZFKKMWXQT-UHFFFAOYSA-N |
| SMILES | CC1(C)CC(=O)c2cc([N+](=O)[O-])ccc21 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 3 | |
CAS#:166978-00-3
CAS#:1133-54-6
CAS#:67159-84-6This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| 1,1-Dimethyl-5-nitro-3-indanone |
| 3,3-Dimethyl-6-nitro-indan-1-on |
| 3,3-dimethyl-6-nitro-1-indanone |
| dimethyl-5-nitroindan-3-one |
| 3,3-dimethyl-6-nitroindan-1-one |
| 6-Nitro-3,3-dimethyl-1-indanone |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the InChIKey of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: InChIKey of 3,3-dimethyl-6-nitro-indan-1-one is QPCPKZFKKMWXQT-UHFFFAOYSA-N. |
| Q: What is the Chinese name of 67159-79-9? |
| A: Chinese name of 67159-79-9 is 67159-79-9. |
| Q: What is the English name of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: The English name of 3,3-dimethyl-6-nitro-indan-1-one is 3,3-dimethyl-6-nitro-indan-1-one. |
| Q: What is the LogP of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: LogP of 3,3-dimethyl-6-nitro-indan-1-one is 2.98200. |
| Q: What is the SMILES notation of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: SMILES notation of 3,3-dimethyl-6-nitro-indan-1-one is CC1(C)CC(=O)c2cc([N+](=O)[O-])ccc21. |
| Q: What is the molecular formula of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: Molecular formula of 3,3-dimethyl-6-nitro-indan-1-one is C11H11NO3. |
| Q: What are the downstream products of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: Related downstream products(CAS) of 3,3-dimethyl-6-nitro-indan-1-one: 166978-00-3;1133-54-6;67159-84-6. |
| Q: What is the CAS number of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: CAS number of 3,3-dimethyl-6-nitro-indan-1-one is 67159-79-9. |
| Q: What English synonyms does 3,3-dimethyl-6-nitro-indan-1-one have? |
| A: English synonyms of 3,3-dimethyl-6-nitro-indan-1-one: 1,1-Dimethyl-5-nitro-3-indanone, 3,3-Dimethyl-6-nitro-indan-1-on, 3,3-dimethyl-6-nitro-1-indanone, dimethyl-5-nitroindan-3-one, 3,3-dimethyl-6-nitroindan-1-one, 6-Nitro-3,3-dimethyl-1-indanone. |
| Q: What is the polar surface area (PSA) of 3,3-dimethyl-6-nitro-indan-1-one? |
| A: Polar surface area (PSA) of 3,3-dimethyl-6-nitro-indan-1-one is 62.89000. |