(4-bromo-2-hydroxy-phenyl)-phenyl-methanone structure
|
Common Name | (4-bromo-2-hydroxy-phenyl)-phenyl-methanone | ||
|---|---|---|---|---|
| CAS Number | 6723-04-2 | Molecular Weight | 277.11300 | |
| Density | 1.521g/cm3 | Boiling Point | 357.5ºC at 760 mmHg | |
| Molecular Formula | C13H9BrO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 170ºC | |
| Name | 4-Brom-2-hydroxy-benzophenon |
|---|
| Density | 1.521g/cm3 |
|---|---|
| Boiling Point | 357.5ºC at 760 mmHg |
| Molecular Formula | C13H9BrO2 |
| Molecular Weight | 277.11300 |
| Flash Point | 170ºC |
| Exact Mass | 275.97900 |
| PSA | 37.30000 |
| LogP | 3.38570 |
| Index of Refraction | 1.639 |
| InChIKey | CLQYOOMZXFSHAT-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(Br)cc1O |
|
~%
(4-bromo-2-hydr... CAS#:6723-04-2 |
| Literature: Choy, Pui Ying; Kwong, Fuk Yee Organic Letters, 2013 , vol. 15, # 2 p. 270 - 273 |
|
~%
(4-bromo-2-hydr... CAS#:6723-04-2 |
| Literature: Cires, Lenuta; Ofenberg, Harry; Craita, Cotinica Organic Preparations and Procedures International, 2001 , vol. 33, # 4 p. 361 - 368 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |