4-Bromobenzophenone structure
|
Common Name | 4-Bromobenzophenone | ||
|---|---|---|---|---|
| CAS Number | 90-90-4 | Molecular Weight | 261.114 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 346.8±15.0 °C at 760 mmHg | |
| Molecular Formula | C13H9BrO | Melting Point | 79-84 °C(lit.) | |
| MSDS | USA | Flash Point | 81.3±7.7 °C | |
| Name | 4-bromobenzophenone |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 346.8±15.0 °C at 760 mmHg |
| Melting Point | 79-84 °C(lit.) |
| Molecular Formula | C13H9BrO |
| Molecular Weight | 261.114 |
| Flash Point | 81.3±7.7 °C |
| Exact Mass | 259.983673 |
| PSA | 17.07000 |
| LogP | 4.12 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.610 |
| InChIKey | KEOLYBMGRQYQTN-UHFFFAOYSA-N |
| SMILES | O=C(c1ccccc1)c1ccc(Br)cc1 |
CHEMICAL IDENTIFICATION
HEALTH HAZARD DATAACUTE TOXICITY DATA
|
| Personal Protective Equipment | Eyeshields;Gloves;type N95 (US);type P1 (EN143) respirator filter |
|---|---|
| Hazard Codes | Xi: Irritant; |
| Risk Phrases | R36/37/38 |
| Safety Phrases | S37/39-S26 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| RTECS | DJ0350000 |
| HS Code | 2914700090 |
| Precursor 10 | |
|---|---|
| DownStream 9 | |
| HS Code | 2914700090 |
|---|---|
| Summary | HS: 2914700090 halogenated, sulphonated, nitrated or nitrosated derivatives of ketones and quinones, whether or not with other oxygen function Tax rebate rate:9.0% Supervision conditions:none VAT:17.0% MFN tariff:5.5% General tariff:30.0% |
|
Reversible multistimuli-response fluorescent switch based on tetraphenylethene-spiropyran molecules.
Chemistry 21(3) , 1149-55, (2015) Two tetraphenylethene (TPE)-functionalized spiropyran (SP) molecules with very similar structure were designed and synthesized. The two molecules exhibit aggregation-induced emission (AIE) properties,... |
| (4-Bromophenyl)(phenyl)methanone |
| 4-bromobenzophenone |
| MFCD00000103 |
| (4-bromophenyl)-phenylmethanone |
| EINECS 202-024-9 |