1,4-PHENYLENE DIACRYLATE structure
|
Common Name | 1,4-PHENYLENE DIACRYLATE | ||
|---|---|---|---|---|
| CAS Number | 6729-79-9 | Molecular Weight | 218.20500 | |
| Density | 1.161g/cm3 | Boiling Point | 352.6ºC at 760 mmHg | |
| Molecular Formula | C12H10O4 | Melting Point | 88-89ºC | |
| MSDS | N/A | Flash Point | 178.4ºC | |
| Name | 1,4-phenylene diacrylate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.161g/cm3 |
|---|---|
| Boiling Point | 352.6ºC at 760 mmHg |
| Melting Point | 88-89ºC |
| Molecular Formula | C12H10O4 |
| Molecular Weight | 218.20500 |
| Flash Point | 178.4ºC |
| Exact Mass | 218.05800 |
| PSA | 52.60000 |
| LogP | 1.86940 |
| Index of Refraction | 1.525 |
| InChIKey | JMMVHMOAIMOMOF-UHFFFAOYSA-N |
| SMILES | C=CC(=O)Oc1ccc(OC(=O)C=C)cc1 |
| Hazard Codes | Xi |
|---|---|
| Risk Phrases | 36/37/38 |
| Safety Phrases | 26-36/37/39 |
| HS Code | 2916399090 |
|
~88%
1,4-PHENYLENE D... CAS#:6729-79-9 |
| Literature: Ates, Sahin; Aydogan, Binnur; Torun, Lokman; Yagci, Yusuf Polymer, 2010 , vol. 51, # 4 p. 825 - 831 |
|
~87%
1,4-PHENYLENE D... CAS#:6729-79-9 |
| Literature: Jung, Hee Kim; Park, Eun-Soo; Jae, Hun Shim; Kim, Mal-Nam; Moon, Woong-Sik; Chung, Kyoo-Hyun; Yoon, Jin-San Journal of Agricultural and Food Chemistry, 2004 , vol. 52, # 25 p. 7480 - 7483 |
|
~%
1,4-PHENYLENE D... CAS#:6729-79-9 |
| Literature: BASF Patent: US2883418 , 1954 ; |
|
~%
1,4-PHENYLENE D... CAS#:6729-79-9 |
| Literature: Jung, Hee Kim; Park, Eun-Soo; Jae, Hun Shim; Kim, Mal-Nam; Moon, Woong-Sik; Chung, Kyoo-Hyun; Yoon, Jin-San Journal of Agricultural and Food Chemistry, 2004 , vol. 52, # 25 p. 7480 - 7483 |
| Precursor 4 | |
|---|---|
| DownStream 0 | |
| HS Code | 2916399090 |
|---|---|
| Summary | 2916399090 other aromatic monocarboxylic acids, their anhydrides, halides, peroxides, peroxyacids and their derivatives VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
| p-bisacryloxybenzene |
| Benzene-1,4-diol diacrylate |
| 1,4-Bis-acryloyloxy-benzol |
| quinol diacrylate |
| 1,4-bis-acryloyloxy-benzene |
| 1,4-Phenylene bisacrylate |
| P-PHENYLENE DIACRYLATE |
| Hydroquinone diacrylate (p-Phenylene diacrylate) |
| 1,4-diacryloyloxybenzene |
| Bis(acrylic acid)p-phenylene ester |
| Einecs 229-780-2 |
| Bisacrylic acid benzene-1,4-diyl ester |
| HYDROQUINONE DIACRYLATE |