4-Bromo-7-methoxyisatin structure
|
Common Name | 4-Bromo-7-methoxyisatin | ||
|---|---|---|---|---|
| CAS Number | 67303-38-2 | Molecular Weight | 256.05300 | |
| Density | 1.733g/cm3 | Boiling Point | N/A | |
| Molecular Formula | C9H6BrNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-bromo-7-methoxy-1H-indole-2,3-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.733g/cm3 |
|---|---|
| Molecular Formula | C9H6BrNO3 |
| Molecular Weight | 256.05300 |
| Exact Mass | 254.95300 |
| PSA | 55.40000 |
| LogP | 1.73050 |
| Index of Refraction | 1.618 |
| InChIKey | UPLXITZBWUCNFA-UHFFFAOYSA-N |
| SMILES | COc1ccc(Br)c2c1NC(=O)C2=O |
| Hazard Codes | Xi |
|---|---|
| HS Code | 2933990090 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 4-bromo-7-methoxy-indole-2,3-dione |
| 4-BROMO-7-METHOXYISATIN |
| 4-Bromo-7-methoxyindoline-2,3-dione |