2-naphthalen-2-ylsulfanylnaphthalene-1,4-dione structure
|
Common Name | 2-naphthalen-2-ylsulfanylnaphthalene-1,4-dione | ||
|---|---|---|---|---|
| CAS Number | 67304-40-9 | Molecular Weight | 316.37300 | |
| Density | 1.36g/cm3 | Boiling Point | 514.7ºC at 760 mmHg | |
| Molecular Formula | C20H12O2S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 226.7ºC | |
| Name | 2-naphthalen-2-ylsulfanylnaphthalene-1,4-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.36g/cm3 |
|---|---|
| Boiling Point | 514.7ºC at 760 mmHg |
| Molecular Formula | C20H12O2S |
| Molecular Weight | 316.37300 |
| Flash Point | 226.7ºC |
| Exact Mass | 316.05600 |
| PSA | 59.44000 |
| LogP | 4.89500 |
| Index of Refraction | 1.741 |
| InChIKey | XHVMRUYTTMKMER-UHFFFAOYSA-N |
| SMILES | O=C1C=C(Sc2ccc3ccccc3c2)C(=O)c2ccccc21 |
|
~%
2-naphthalen-2-... CAS#:67304-40-9 |
| Literature: Fieser; Brown Journal of the American Chemical Society, 1949 , vol. 71, p. 3615 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
|
Name: NCI human tumor cell line growth inhibition assay. Data for the MCF7 Non-Small Cell L...
Source: DTP/NCI
Target: N/A
External Id: MCF7_OneDose
|
|
Name: NCI human tumor cell line growth inhibition assay. Data for the IGROV1 Non-Small Cell...
Source: DTP/NCI
Target: N/A
External Id: IGROV1_OneDose
|
| 2-[2]naphthylsulfanyl-[1,4]naphthoquinone |
| 2-[2]Naphthylmercapto-[1,4]naphthochinon |