5-Iminodaunorubicin structure
|
Common Name | 5-Iminodaunorubicin | ||
|---|---|---|---|---|
| CAS Number | 67324-99-6 | Molecular Weight | 562.99600 | |
| Density | 1.51g/cm3 | Boiling Point | 864.9ºC at 760 mmHg | |
| Molecular Formula | C27H31ClN2O9 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 476.9ºC | |
Use of 5-Iminodaunorubicin5-Iminodaunorubicin hydrochloride is a quinone-modified anthracycline that retains antitumor activity[1]. 5-Iminodaunorubicin hydrochloride produces protein-concealed DNA strand breaks in cancer cells[2]. |
| Name | 12-Iminodaunorubicin HCl |
|---|---|
| Synonym | More Synonyms |
| Description | 5-Iminodaunorubicin hydrochloride is a quinone-modified anthracycline that retains antitumor activity[1]. 5-Iminodaunorubicin hydrochloride produces protein-concealed DNA strand breaks in cancer cells[2]. |
|---|---|
| Related Catalog | |
| In Vitro | In mouse leukemia L1210 cells, 5-Iminodaunorubicin produces protein-concealed DNA strand breaks. Many of the 5-iminodaunorubicin breaks may arise from apposed single-strand breaks (i.e., double-strand breaks)[2]. |
| In Vivo | In rat, 5-Iminodaunorubicin (5-ID; 1-16 mg/kg) treatment produces widening of the QRS complex, increased R- and S-wave voltage, and prolonged the Q alpha T interval. And the quinone redox cycling is suppressed in 5-Iminodaunorubicin. 5-Iminodaunorubicin shows lower cardiotoxic[1]. |
| References |
| Density | 1.51g/cm3 |
|---|---|
| Boiling Point | 864.9ºC at 760 mmHg |
| Molecular Formula | C27H31ClN2O9 |
| Molecular Weight | 562.99600 |
| Flash Point | 476.9ºC |
| Exact Mass | 562.17200 |
| PSA | 192.62000 |
| LogP | 2.81610 |
| Index of Refraction | 1.698 |
| InChIKey | KVTVLWOKIDKIQL-KOFUDPRISA-N |
| SMILES | COc1cccc2c1C(=N)c1c(O)c3c(c(O)c1C2=O)CC(O)(C(C)=O)CC3OC1CC(N)C(O)C(C)O1.Cl |
| 5-iminodaunorubicin hydrochloride |
| aromatic/heteroaromatic sulfonamide 14 |
| 5-Imino-4-methyl-4,5-dihydro-[1,3,4]thiadiazol-2-sulfonsaeure-amid |
| 5-imino-4-methyl-4,5-dihydro-[1,3,4]thiadiazole-2-sulfonic acid amide |
| 5-iminodaunomycin hydrochloride |
| 1,3,4-Thiadiazole-2-sulfonamide,4,5-dihydro-5-imino-4-methyl |