(1S,2S)-(-)-1,2-Diaminocyclohexane L-Tartrate structure
|
Common Name | (1S,2S)-(-)-1,2-Diaminocyclohexane L-Tartrate | ||
|---|---|---|---|---|
| CAS Number | 67333-70-4 | Molecular Weight | 264.276 | |
| Density | N/A | Boiling Point | 399.3ºC at 760 mmHg | |
| Molecular Formula | C10H20N2O6 | Melting Point | 280-284ºC | |
| MSDS | Chinese USA | Flash Point | 209.4ºC | |
| Symbol |
GHS07 |
Signal Word | Warning | |
| Name | (1S,2S)-(-)-1,2-Diaminocyclohexane L-Tartrate |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 399.3ºC at 760 mmHg |
|---|---|
| Melting Point | 280-284ºC |
| Molecular Formula | C10H20N2O6 |
| Molecular Weight | 264.276 |
| Flash Point | 209.4ºC |
| Exact Mass | 264.132141 |
| PSA | 167.10000 |
| Index of Refraction | -13 ° (C=2.5, H2O) |
| InChIKey | GDOTUTAQOJUZOF-SCDVTJNCSA-N |
| SMILES | NC1CCCCC1N.O=C(O)C(O)C(O)C(=O)O |
| Symbol |
GHS07 |
|---|---|
| Signal Word | Warning |
| Hazard Statements | H302-H312-H332 |
| Precautionary Statements | P280 |
| Personal Protective Equipment | dust mask type N95 (US);Eyeshields;Gloves |
| Hazard Codes | Xn:Harmful; |
| Risk Phrases | R20/21/22 |
| Safety Phrases | S36 |
| RIDADR | NONH for all modes of transport |
| WGK Germany | 3 |
| HS Code | 2922509090 |
| HS Code | 2922509090 |
|---|---|
| Summary | 2922509090. other amino-alcohol-phenols, amino-acid-phenols and other amino-compounds with oxygen function. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| (1S,2S)-cyclohexane-1,2-diamine,(2S,3S)-2,3-dihydroxybutanedioic acid |
| Butanedioic acid, 2,3-dihydroxy-, (2S,3S)-, compd. with (1R,2R)-1,2-cyclohexanediamine (1:1) |
| (2S,3S)-2,3-Dihydroxysuccinic acid - (1R,2R)-cyclohexane-1,2-diamine (1:1) |
| MFCD00191980 |
| (2S,3S)-2,3-Dihydroxysuccinic acid - (1R,2R)-1,2-cyclohexanediamine (1:1) |