Methanamine,N-(6,7,8-trimethyl-2(8H)-pteridinylidene)- structure
|
Common Name | Methanamine,N-(6,7,8-trimethyl-2(8H)-pteridinylidene)- | ||
|---|---|---|---|---|
| CAS Number | 6743-27-7 | Molecular Weight | 203.24400 | |
| Density | 1.24g/cm3 | Boiling Point | 300.3ºC at 760mmHg | |
| Molecular Formula | C10H13N5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 135.4ºC | |
| Name | 1,1':3',1''-Terphenyl,4-methoxy-5'-phenyl |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 300.3ºC at 760mmHg |
| Molecular Formula | C10H13N5 |
| Molecular Weight | 203.24400 |
| Flash Point | 135.4ºC |
| Exact Mass | 203.11700 |
| PSA | 55.96000 |
| LogP | 0.51060 |
| Index of Refraction | 1.644 |
| InChIKey | HHBWDTWEPWIWMZ-UHFFFAOYSA-N |
| SMILES | CN=c1ncc2nc(C)c(C)n(C)c-2n1 |
|
~%
Methanamine,N-(... CAS#:6743-27-7 |
| Literature: Fidler; Wood Journal of the Chemical Society, 1957 , p. 4157,4160 |
| Precursor 1 | |
|---|---|
| DownStream 0 | |
| 4-m-terphenyl-5'-yl-anisole |
| 4-Methoxy-5'-phenyl-m-terphenyl |
| 4-m-Terphenyl-5'-yl-anisol |
| Methyl-(6,7,8-trimethyl-8H-pteridin-2-yliden)-amin |
| Methyl-(5'-phenyl-m-terphenylyl-(4))-aether |
| methyl-(6,7,8-trimethyl-8H-pteridin-2-yliden)-amine |
| methyl-(6,7,8-trimethyl-8H-pteridin-2-ylidene)-amine |
| 6,7,8-Trimethyl-2-methylimino-2,8-dihydro-pteridin |