2,4-Pyrimidinediamine,N2,N4-dimethyl-5-nitro- structure
|
Common Name | 2,4-Pyrimidinediamine,N2,N4-dimethyl-5-nitro- | ||
|---|---|---|---|---|
| CAS Number | 5177-26-4 | Molecular Weight | 183.16800 | |
| Density | 1.446g/cm3 | Boiling Point | 399.5ºC at 760 mmHg | |
| Molecular Formula | C6H9N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 195.4ºC | |
| Name | 2-N,4-N-dimethyl-5-nitropyrimidine-2,4-diamine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.446g/cm3 |
|---|---|
| Boiling Point | 399.5ºC at 760 mmHg |
| Molecular Formula | C6H9N5O2 |
| Molecular Weight | 183.16800 |
| Flash Point | 195.4ºC |
| Exact Mass | 183.07600 |
| PSA | 95.66000 |
| LogP | 1.13740 |
| Index of Refraction | 1.686 |
| InChIKey | UVGZZHJGNJMHRB-UHFFFAOYSA-N |
| SMILES | CNc1ncc([N+](=O)[O-])c(NC)n1 |
|
~84%
2,4-Pyrimidined... CAS#:5177-26-4 |
| Literature: DECIPHERA PHARMACEUTICALS, LLC Patent: WO2008/33999 A2, 2008 ; Location in patent: Page/Page column 92 ; |
|
~99%
2,4-Pyrimidined... CAS#:5177-26-4 |
| Literature: IRM LLC Patent: WO2006/2367 A1, 2006 ; Location in patent: Page/Page column 23-24 ; WO 2006/002367 A1 |
|
~%
Detail
|
| Literature: Brown Journal of Applied Chemistry, 1954 , vol. 4, p. 72,74 |
| n,n'-dimethyl-5-nitropyrimidine-2,4-diamine |