4-amino-3-phenyl-quinazolin-2-one structure
|
Common Name | 4-amino-3-phenyl-quinazolin-2-one | ||
|---|---|---|---|---|
| CAS Number | 67461-76-1 | Molecular Weight | 237.25700 | |
| Density | 1.3g/cm3 | Boiling Point | 435.1ºC at 760 mmHg | |
| Molecular Formula | C14H11N3O | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 216.9ºC | |
| Name | 4-amino-3-phenylquinazolin-2-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.3g/cm3 |
|---|---|
| Boiling Point | 435.1ºC at 760 mmHg |
| Molecular Formula | C14H11N3O |
| Molecular Weight | 237.25700 |
| Flash Point | 216.9ºC |
| Exact Mass | 237.09000 |
| PSA | 61.64000 |
| LogP | 1.89800 |
| Index of Refraction | 1.685 |
| InChIKey | ZQNBYRQHHWQOEZ-UHFFFAOYSA-N |
| SMILES | Nc1c2ccccc2nc(=O)n1-c1ccccc1 |
|
~%
4-amino-3-pheny... CAS#:67461-76-1 |
| Literature: Mirallai, Styliana I.; Manos, Manolis J.; Koutentis, Panayiotis A. Journal of Organic Chemistry, 2013 , vol. 78, # 19 p. 9906 - 9913 |
| Precursor 1 | |
|---|---|
| DownStream 1 | |
| 2-Oxo-4-imino-3-phenyl-1,2,3,4-tetrahydro-chinazolin |
| 2-oxo-3-phenyl-4-imino-1,2,3,4-tetrahydroquinazoline |
| 4-imino-3-phenyl-1,2,3,4-tetrahydroquinazolin-2-one |
| 4-imino-3-phenyl-3,4-dihydro-1H-quinazolin-2-one |