tert-Butyl-4,7-diazaspiro[2.5]octan-4-carboxylat
![tert-Butyl-4,7-diazaspiro[2.5]octan-4-carboxylat Structure](https://image.chemsrc.com/caspic/081/674792-08-6.png)
tert-Butyl-4,7-diazaspiro[2.5]octan-4-carboxylat structure
|
Common Name | tert-Butyl-4,7-diazaspiro[2.5]octan-4-carboxylat | ||
|---|---|---|---|---|
| CAS Number | 674792-08-6 | Molecular Weight | 212.289 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 301.3±17.0 °C at 760 mmHg | |
| Molecular Formula | C11H20N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 136.0±20.9 °C | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 4-Boc-4,7-diazaspiro[2.5]octane |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 301.3±17.0 °C at 760 mmHg |
| Molecular Formula | C11H20N2O2 |
| Molecular Weight | 212.289 |
| Flash Point | 136.0±20.9 °C |
| Exact Mass | 212.152481 |
| PSA | 41.57000 |
| LogP | 0.94 |
| Vapour Pressure | 0.0±0.6 mmHg at 25°C |
| Index of Refraction | 1.521 |
| InChIKey | XNLYPHAMXHERHS-UHFFFAOYSA-N |
| SMILES | CC(C)(C)OC(=O)N1CCNCC12CC2 |
| Storage condition | 2-8°C |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| Hazard Codes | Xi |
|---|
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| tert-Butyl-4,7-diazaspiro[2.5]octan-4-carboxylat |
| 4,7-Diazaspiro[2.5]octane-4-carboxylic acid, 1,1-dimethylethyl ester |
| tert-butyl 4,7-diazaspiro[2.5]octane-4-carboxylate |
| 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What are the storage conditions for 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: Storage conditions for 4-Boc-4,7-diazaspiro[2.5]octane: 2-8°C. |
| Q: What is the polar surface area (PSA) of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: Polar surface area (PSA) of 4-Boc-4,7-diazaspiro[2.5]octane is 41.57000. |
| Q: What is the boiling point of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: Boiling point of 4-Boc-4,7-diazaspiro[2.5]octane is 301.3±17.0 °C at 760 mmHg. |
| Q: What English synonyms does 4-Boc-4,7-diazaspiro[2.5]octane have? |
| A: English synonyms of 4-Boc-4,7-diazaspiro[2.5]octane: tert-Butyl-4,7-diazaspiro[2.5]octan-4-carboxylat, 4,7-Diazaspiro[2.5]octane-4-carboxylic acid, 1,1-dimethylethyl ester, tert-butyl 4,7-diazaspiro[2.5]octane-4-carboxylate, 2-Methyl-2-propanyl 4,7-diazaspiro[2.5]octane-4-carboxylate. |
| Q: What is the molecular weight of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: Molecular weight of 4-Boc-4,7-diazaspiro[2.5]octane is 212.289. |
| Q: What is the molecular formula of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: Molecular formula of 4-Boc-4,7-diazaspiro[2.5]octane is C11H20N2O2. |
| Q: What is the SMILES notation of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: SMILES notation of 4-Boc-4,7-diazaspiro[2.5]octane is CC(C)(C)OC(=O)N1CCNCC12CC2. |
| Q: What is the LogP of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: LogP of 4-Boc-4,7-diazaspiro[2.5]octane is 0.94. |
| Q: What is the CAS number of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: CAS number of 4-Boc-4,7-diazaspiro[2.5]octane is 674792-08-6. |
| Q: What is the InChIKey of 4-Boc-4,7-diazaspiro[2.5]octane? |
| A: InChIKey of 4-Boc-4,7-diazaspiro[2.5]octane is XNLYPHAMXHERHS-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Shanghai Nianxing Industrial Co., Ltd |
| Dayang Chem (Hangzhou) Co., Ltd. |