4-methyl-N-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)benzenesulfonamide
Modify Date: 2026-08-02 20:23:43
4-methyl-N-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)benzenesulfonamide structure
|
Common Name | 4-methyl-N-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)benzenesulfonamide | ||
|---|---|---|---|---|
| CAS Number | 67508-22-9 | Molecular Weight | 443.57900 | |
| Density | 1.264g/cm3 | Boiling Point | 603.2ºC at 760 mmHg | |
| Molecular Formula | C23H25NO4S2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
| Name | 4-methyl-N-(4-methylphenyl)sulfonyl-N-(3-phenylpropyl)benzenesulfonamide |
|---|
| Density | 1.264g/cm3 |
|---|---|
| Boiling Point | 603.2ºC at 760 mmHg |
| Molecular Formula | C23H25NO4S2 |
| Molecular Weight | 443.57900 |
| Exact Mass | 443.12300 |
| PSA | 88.28000 |
| LogP | 6.47740 |
| Index of Refraction | 1.604 |
| InChIKey | IDEFOUDUSHBRKQ-UHFFFAOYSA-N |
| SMILES | Cc1ccc(S(=O)(=O)N(CCCc2ccccc2)S(=O)(=O)c2ccc(C)cc2)cc1 |
|
~%
4-methyl-N-(4-m... CAS#:67508-22-9 |
| Literature: Cope; McElvain Journal of the American Chemical Society, 1931 , vol. 53, p. 1587,1589 |
|
~%
4-methyl-N-(4-m... CAS#:67508-22-9 |
| Literature: Cope; McElvain Journal of the American Chemical Society, 1931 , vol. 53, p. 1587,1589 |
| Precursor 3 | |
|---|---|
| DownStream 0 | |