1-butyl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea structure
|
Common Name | 1-butyl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea | ||
|---|---|---|---|---|
| CAS Number | 67616-05-1 | Molecular Weight | 280.36300 | |
| Density | 1.047g/cm3 | Boiling Point | 466.1ºC at 760 mmHg | |
| Molecular Formula | C15H24N2O3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 235.7ºC | |
| Name | 1-butyl-3-[2-(3,4-dimethoxyphenyl)ethyl]urea |
|---|
| Density | 1.047g/cm3 |
|---|---|
| Boiling Point | 466.1ºC at 760 mmHg |
| Molecular Formula | C15H24N2O3 |
| Molecular Weight | 280.36300 |
| Flash Point | 235.7ºC |
| Exact Mass | 280.17900 |
| PSA | 59.59000 |
| LogP | 3.12740 |
| Index of Refraction | 1.506 |
| InChIKey | YAKQAOSIMCLQBM-UHFFFAOYSA-N |
| SMILES | CCCCNC(=O)NCCc1ccc(OC)c(OC)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |