2',6'-Dichloro-2-morpholinoacetanilide structure
|
Common Name | 2',6'-Dichloro-2-morpholinoacetanilide | ||
|---|---|---|---|---|
| CAS Number | 67624-90-2 | Molecular Weight | 289.15800 | |
| Density | 1.338g/cm3 | Boiling Point | 472.7ºC at 760 mmHg | |
| Molecular Formula | C12H14Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
| Name | N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 472.7ºC at 760 mmHg |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.15800 |
| Flash Point | 239.7ºC |
| Exact Mass | 288.04300 |
| PSA | 53.85000 |
| LogP | 3.28870 |
| Index of Refraction | 1.578 |
| InChIKey | UBIWBGWRYUMRCR-UHFFFAOYSA-N |
| SMILES | O=C(CC1CNCCO1)Nc1c(Cl)cccc1Cl |
|
~%
2',6'-Dichloro-... CAS#:67624-90-2 |
| Literature: Ehrhardt; Rouot; Schwartz European Journal of Medicinal Chemistry, 1978 , vol. 13, # 3 p. 235 - 240 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| ACETANILIDE,2',6'-DICHLORO-2-MORPHOLINO |
| 2',6'-Dichloro-2-morpholinoacetanilide |