2',6'-Dichloro-2-morpholinoacetanilide
2',6'-Dichloro-2-morpholinoacetanilide structure
|
Common Name | 2',6'-Dichloro-2-morpholinoacetanilide | ||
|---|---|---|---|---|
| CAS Number | 67624-90-2 | Molecular Weight | 289.15800 | |
| Density | 1.338g/cm3 | Boiling Point | 472.7ºC at 760 mmHg | |
| Molecular Formula | C12H14Cl2N2O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 239.7ºC | |
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide |
|---|---|
| Synonym | More Synonyms |
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Density | 1.338g/cm3 |
|---|---|
| Boiling Point | 472.7ºC at 760 mmHg |
| Molecular Formula | C12H14Cl2N2O2 |
| Molecular Weight | 289.15800 |
| Flash Point | 239.7ºC |
| Exact Mass | 288.04300 |
| PSA | 53.85000 |
| LogP | 3.28870 |
| Index of Refraction | 1.578 |
| InChIKey | UBIWBGWRYUMRCR-UHFFFAOYSA-N |
| SMILES | O=C(CC1CNCCO1)Nc1c(Cl)cccc1Cl |
This table presents publicly reported synthetic routes, reaction conditions, reactants and product information of the compound.
|
~%
2',6'-Dichloro-... CAS#:67624-90-2 |
| Literature: Ehrhardt; Rouot; Schwartz European Journal of Medicinal Chemistry, 1978 , vol. 13, # 3 p. 235 - 240 |
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 2 | |
|---|---|
| DownStream 0 | |
This table collects all English aliases, systematic names and CAS‑related synonyms of the compound.
| ACETANILIDE,2',6'-DICHLORO-2-MORPHOLINO |
| 2',6'-Dichloro-2-morpholinoacetanilide |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the molecular weight of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: Molecular weight of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is 289.15800. |
| Q: What is the CAS number of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: CAS number of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is 67624-90-2. |
| Q: What is the molecular formula of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: Molecular formula of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is C12H14Cl2N2O2. |
| Q: What is the boiling point of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: Boiling point of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is 472.7ºC at 760 mmHg. |
| Q: What is the SMILES notation of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: SMILES notation of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is O=C(CC1CNCCO1)Nc1c(Cl)cccc1Cl. |
| Q: What is the polar surface area (PSA) of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: Polar surface area (PSA) of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is 53.85000. |
| Q: What is the LogP of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: LogP of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is 3.28870. |
| Q: What are the upstream materials of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: Related upstream materials(CAS) of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide: 110-91-8;17700-54-8. |
| Q: What is the English name of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: The English name of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide. |
| Q: What is the InChIKey of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide? |
| A: InChIKey of N-(2,6-dichlorophenyl)-2-morpholin-2-ylacetamide is UBIWBGWRYUMRCR-UHFFFAOYSA-N. |
This table lists manufacturers and suppliers of this compound, including vendor names and product supply reference information.
| Dayang Chem (Hangzhou) Co., Ltd. |