2-(2,5-dichlorophenyl)-1-morpholin-4-yl-ethanethione structure
|
Common Name | 2-(2,5-dichlorophenyl)-1-morpholin-4-yl-ethanethione | ||
|---|---|---|---|---|
| CAS Number | 67643-08-7 | Molecular Weight | 290.20900 | |
| Density | 1.367g/cm3 | Boiling Point | 402.8ºC at 760 mmHg | |
| Molecular Formula | C12H13Cl2NOS | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 197.4ºC | |
| Name | 2-(2,5-dichlorophenyl)-1-morpholin-4-ylethanethione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.367g/cm3 |
|---|---|
| Boiling Point | 402.8ºC at 760 mmHg |
| Molecular Formula | C12H13Cl2NOS |
| Molecular Weight | 290.20900 |
| Flash Point | 197.4ºC |
| Exact Mass | 289.00900 |
| PSA | 44.56000 |
| LogP | 3.13340 |
| Index of Refraction | 1.617 |
| InChIKey | INLKJJSLTUQSJV-UHFFFAOYSA-N |
| SMILES | S=C(Cc1cc(Cl)ccc1Cl)N1CCOCC1 |
|
~%
2-(2,5-dichloro... CAS#:67643-08-7 |
| Literature: King; McMillan Journal of the American Chemical Society, 1946 , vol. 68, p. 2335,2338 |
|
~%
2-(2,5-dichloro... CAS#:67643-08-7 |
| Literature: Berkovic Journal of Organic Chemistry, 1955 , vol. 20, p. 1322,1324 |
| 2-(2,5-dichlorophenyl)-1-(morpholin-4-yl)ethanethione |
| 4-[(2,5-Dichlor-phenyl)-thioacetyl]-morpholin |
| (2,5-Dichlorphenyl)acetothiomorpholid |
| 4-[(2,5-dichloro-phenyl)-thioacetyl]-morpholine |