2-(4-hydroxy-3,5-dimethylbenzoyl)-4-benzopyrone structure
|
Common Name | 2-(4-hydroxy-3,5-dimethylbenzoyl)-4-benzopyrone | ||
|---|---|---|---|---|
| CAS Number | 67652-27-1 | Molecular Weight | 294.30100 | |
| Density | 1.319g/cm3 | Boiling Point | 492.3ºC at 760 mmHg | |
| Molecular Formula | C18H14O4 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 182.7ºC | |
| Name | 2-(4-hydroxy-3,5-dimethylbenzoyl)chromen-4-one |
|---|---|
| Synonym | More Synonyms |
| Density | 1.319g/cm3 |
|---|---|
| Boiling Point | 492.3ºC at 760 mmHg |
| Molecular Formula | C18H14O4 |
| Molecular Weight | 294.30100 |
| Flash Point | 182.7ºC |
| Exact Mass | 294.08900 |
| PSA | 67.51000 |
| LogP | 3.34640 |
| Index of Refraction | 1.645 |
| InChIKey | NJABAKPWQDHIPN-UHFFFAOYSA-N |
| SMILES | Cc1cc(C(=O)c2cc(=O)c3ccccc3o2)cc(C)c1O |
|
~72%
2-(4-hydroxy-3,... CAS#:67652-27-1 |
| Literature: Payard; Tronche; Bastide; et al. European Journal of Medicinal Chemistry, 1981 , vol. 16, # 5 p. 453 - 460 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| einecs 266-838-6 |