2-Methoxybenzylidenemalonic Acid Diethyl Ester structure
|
Common Name | 2-Methoxybenzylidenemalonic Acid Diethyl Ester | ||
|---|---|---|---|---|
| CAS Number | 6768-22-5 | Molecular Weight | 278.300 | |
| Density | 1.1±0.1 g/cm3 | Boiling Point | 354.0±27.0 °C at 760 mmHg | |
| Molecular Formula | C15H18O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 152.9±23.8 °C | |
| Name | diethyl 2-[(2-methoxyphenyl)methylidene]propanedioate |
|---|---|
| Synonym | More Synonyms |
| Density | 1.1±0.1 g/cm3 |
|---|---|
| Boiling Point | 354.0±27.0 °C at 760 mmHg |
| Molecular Formula | C15H18O5 |
| Molecular Weight | 278.300 |
| Flash Point | 152.9±23.8 °C |
| Exact Mass | 278.115417 |
| PSA | 61.83000 |
| LogP | 3.10 |
| Vapour Pressure | 0.0±0.8 mmHg at 25°C |
| Index of Refraction | 1.531 |
| InChIKey | SVKFJFJTWYOZCB-UHFFFAOYSA-N |
| SMILES | CCOC(=O)C(=Cc1ccccc1OC)C(=O)OCC |
| HS Code | 2918990090 |
|---|
| HS Code | 2918990090 |
|---|---|
| Summary | 2918990090. other carboxylic acids with additional oxygen function and their anhydrides, halides, peroxides and peroxyacids; their halogenated, sulphonated, nitrated or nitrosated derivatives. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| diethyl 2-methoxybenzylidenemalonate |
| diethyl o-methoxybenzylidenemalonate |
| Propanedioic acid, [(2-methoxyphenyl)methylene]-, diethyl ester |
| Diethyl (2-methoxybenzylidene)malonate |
| 2-Methoxy-benzalmalonsaeure-diaethylester |
| Diethyl 2-(2-methoxybenzylidene)malonate |
| Propanedioic acid, 2-[(2-methoxyphenyl)methylene]-, diethyl ester |
| 2-Methoxybenzylidenemalonic Acid Diethyl Ester |