3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile
3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile structure
|
Common Name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile | ||
|---|---|---|---|---|
| CAS Number | 677-77-0 | Molecular Weight | 193.04700 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C4HF6NO | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Summary: 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile (CAS号：677-77-0), molecular formula C4HF6NO, molecular weight 193.04700. For research-use only, not for medical or clinical usage.
This table lists Chinese names, IUPAC names and various aliases of this chemical substance.
| Name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile |
|---|
This table shows physicochemical parameters including melting point, boiling point, density, solubility and optical rotation. Missing data is marked as N/A.
| Molecular Formula | C4HF6NO |
|---|---|
| Molecular Weight | 193.04700 |
| Exact Mass | 192.99600 |
| PSA | 44.02000 |
| LogP | 1.36568 |
| InChIKey | FIQYSBFGWWJTQS-UHFFFAOYSA-N |
| SMILES | N#CC(O)(C(F)(F)F)C(F)(F)F |
This table covers safety warnings, protective measures, incompatible substances and disposal guidelines for this compound.
| HS Code | 2926909090 |
|---|
This table lists upstream starting materials and downstream derivative products related to this chemical.
| Precursor 0 | |
|---|---|
| DownStream 1 | |
CAS#:662-22-6This table shows customs‑related data including HS‑code, tariff and regulatory conditions for import and export.
| HS Code | 2926909090 |
|---|---|
| Summary | HS:2926909090 other nitrile-function compounds VAT:17.0% Tax rebate rate:9.0% Supervision conditions:none MFN tariff:6.5% General tariff:30.0% |
This section contains frequently‑asked‑questions about this compound, including basic parameters, properties, storage conditions and corresponding answers.
| Q: What is the English name of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: The English name of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile. |
| Q: What is the molecular weight of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: Molecular weight of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is 193.04700. |
| Q: What is the LogP of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: LogP of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is 1.36568. |
| Q: What is the InChIKey of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: InChIKey of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is FIQYSBFGWWJTQS-UHFFFAOYSA-N. |
| Q: What is the polar surface area (PSA) of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: Polar surface area (PSA) of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is 44.02000. |
| Q: What are the downstream products of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: Related downstream products(CAS) of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile: 662-22-6. |
| Q: What is the SMILES notation of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: SMILES notation of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is N#CC(O)(C(F)(F)F)C(F)(F)F. |
| Q: What is the CAS number of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: CAS number of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is 677-77-0. |
| Q: What is the molecular formula of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile? |
| A: Molecular formula of 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanenitrile is C4HF6NO. |
| Q: What is the Chinese name of 677-77-0? |
| A: Chinese name of 677-77-0 is 677-77-0. |