2,2-bis(trifluoromethyl)-2-hydroxyacetic acid structure
|
Common Name | 2,2-bis(trifluoromethyl)-2-hydroxyacetic acid | ||
|---|---|---|---|---|
| CAS Number | 662-22-6 | Molecular Weight | 212.04700 | |
| Density | 1,183 g/cm3 | Boiling Point | 153-156°C | |
| Molecular Formula | C4H2F6O3 | Melting Point | 30°C | |
| MSDS | Chinese USA | Flash Point | 153-156°C | |
| Name | 3,3,3-trifluoro-2-hydroxy-2-(trifluoromethyl)propanoic acid |
|---|---|
| Synonym | More Synonyms |
| Density | 1,183 g/cm3 |
|---|---|
| Boiling Point | 153-156°C |
| Melting Point | 30°C |
| Molecular Formula | C4H2F6O3 |
| Molecular Weight | 212.04700 |
| Flash Point | 153-156°C |
| Exact Mass | 211.99100 |
| PSA | 57.53000 |
| LogP | 0.92670 |
| Index of Refraction | 1.332 |
| InChIKey | CMQUGOHGJUTDGZ-UHFFFAOYSA-N |
| SMILES | O=C(O)C(O)(C(F)(F)F)C(F)(F)F |
| Hazard Codes | C,Xi |
|---|---|
| Risk Phrases | R34 |
| Safety Phrases | S26-S36/37/39-S45 |
| RIDADR | 3265 |
| Packaging Group | III |
| Hazard Class | 8 |
| HS Code | 2918199090 |
|
~%
2,2-bis(trifluo... CAS#:662-22-6 |
| Literature: Khimicheskaya Nauka i Promyshlennost, , vol. 4, p. 802 Chem.Abstr., , p. 10851 |
|
~%
2,2-bis(trifluo... CAS#:662-22-6 |
| Literature: Bulletin of the Academy of Sciences of the USSR, Division of Chemical Science (English Translation), , p. 405 - 407 Izvestiya Akademii Nauk SSSR, Seriya Khimicheskaya, , # 2 p. 415 - 417 |
|
~%
2,2-bis(trifluo... CAS#:662-22-6 |
| Literature: FR2293196DE2554882 , ; Chem.Abstr., , vol. 85, # 94079 |
|
~%
2,2-bis(trifluo... CAS#:662-22-6 |
| Literature: Canadian Journal of Chemistry, , vol. 50, p. 939 - 945 |
| HS Code | 2918199090 |
|---|---|
| Summary | 2918199090 other carboxylic acids with alcohol function but without other oxygen function, their anhydrides, halides, peroxides, peroxyacids and their derivatives。Supervision conditions:None。VAT:17.0%。Tax rebate rate:9.0%。MFN tariff:6.5%。General tariff:30.0% |
| 2,2-bis-trifluoromethyl 2-hydroxyacetic acid |
| 3,3,3-trifluoro-2-hydroxy-2-trifluoromethylpropionic acid |
| PC1253T |
| 3,3,3-Trifluor-2-hydroxy-2-trifluormethyl-propionsaeure |
| 2-hydroxy-2-trifluoromethyl-3,3,3-trifluoropropanoic acid |
| hexafluoro-2-hydroxyisobutyric acid |
| MFCD00190631 |