3,6,9,12,15-pentaoxa-19-azabicyclo[15.3.1]henicosa-17,19,21-triene-2,16-dione structure
|
Common Name | 3,6,9,12,15-pentaoxa-19-azabicyclo[15.3.1]henicosa-17,19,21-triene-2,16-dione | ||
|---|---|---|---|---|
| CAS Number | 67705-78-6 | Molecular Weight | 325.31400 | |
| Density | 1.192g/cm3 | Boiling Point | 607.6ºC at 760 mmHg | |
| Molecular Formula | C15H19NO7 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 321.3ºC | |
| Name | 3,6,9,12,15-pentaoxa-19-azabicyclo[15.3.1]henicosa-1(21),17,19-triene-2,16-dione |
|---|---|
| Synonym | More Synonyms |
| Density | 1.192g/cm3 |
|---|---|
| Boiling Point | 607.6ºC at 760 mmHg |
| Molecular Formula | C15H19NO7 |
| Molecular Weight | 325.31400 |
| Flash Point | 321.3ºC |
| Exact Mass | 325.11600 |
| PSA | 93.18000 |
| LogP | 0.45860 |
| Index of Refraction | 1.477 |
| InChIKey | WMIWUXDPOTVBSF-UHFFFAOYSA-N |
| SMILES | O=C1OCCOCCOCCOCCOC(=O)c2cncc1c2 |
|
~%
3,6,9,12,15-pen... CAS#:67705-78-6 |
| Literature: Bradshaw,J.S. et al. Journal of Heterocyclic Chemistry, 1978 , vol. 15, p. 825 - 831 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| 3,6,9,12,15-pentaoxa-1(3,5)-pyridina-cyclohexadecaphane-2,16-dione |