1-(2-Methoxy-4-nitrophenyl)pyrrolidine structure
|
Common Name | 1-(2-Methoxy-4-nitrophenyl)pyrrolidine | ||
|---|---|---|---|---|
| CAS Number | 67828-57-3 | Molecular Weight | 222.24000 | |
| Density | 1.235g/cm3 | Boiling Point | 391.8ºC at 760mmHg | |
| Molecular Formula | C11H14N2O3 | Melting Point | 60ºC | |
| MSDS | N/A | Flash Point | 190.7ºC | |
| Name | 1-(2-Methoxy-4-nitrophenyl)pyrrolidine |
|---|---|
| Synonym | More Synonyms |
| Density | 1.235g/cm3 |
|---|---|
| Boiling Point | 391.8ºC at 760mmHg |
| Melting Point | 60ºC |
| Molecular Formula | C11H14N2O3 |
| Molecular Weight | 222.24000 |
| Flash Point | 190.7ºC |
| Exact Mass | 222.10000 |
| PSA | 58.29000 |
| LogP | 2.79180 |
| Index of Refraction | 1.578 |
| InChIKey | ULBJILHSWMGASA-UHFFFAOYSA-N |
| SMILES | COc1cc([N+](=O)[O-])ccc1N1CCCC1 |
| HS Code | 2933990090 |
|---|
|
~%
1-(2-Methoxy-4-... CAS#:67828-57-3 |
| Literature: US2007/185097 A1, ; Page/Page column 15 ; US 20070185097 A1 |
| HS Code | 2933990090 |
|---|---|
| Summary | 2933990090. heterocyclic compounds with nitrogen hetero-atom(s) only. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:20.0% |
| 1-(2-methoxy-4-nitrophenyl)pyrrolidine |