methyl 2-[(3-chlorobenzoyl)amino]benzoate
Modify Date: 2025-11-26 12:04:51
![methyl 2-[(3-chlorobenzoyl)amino]benzoate Structure](https://image.chemsrc.com/caspic/426/67836-47-9.png)
methyl 2-[(3-chlorobenzoyl)amino]benzoate structure
|
Common Name | methyl 2-[(3-chlorobenzoyl)amino]benzoate | ||
|---|---|---|---|---|
| CAS Number | 67836-47-9 | Molecular Weight | 289.71400 | |
| Density | 1.328g/cm3 | Boiling Point | 362.6ºC at 760 mmHg | |
| Molecular Formula | C15H12ClNO3 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 173.1ºC | |
| Name | methyl 2-[(3-chlorobenzoyl)amino]benzoate |
|---|
| Density | 1.328g/cm3 |
|---|---|
| Boiling Point | 362.6ºC at 760 mmHg |
| Molecular Formula | C15H12ClNO3 |
| Molecular Weight | 289.71400 |
| Flash Point | 173.1ºC |
| Exact Mass | 289.05100 |
| PSA | 55.40000 |
| LogP | 3.45190 |
| Index of Refraction | 1.628 |
| InChIKey | WFXJKIPVHFUFBE-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)c1cccc(Cl)c1 |
| HS Code | 2924299090 |
|---|
|
~%
methyl 2-[(3-ch... CAS#:67836-47-9 |
| Literature: Kirino; Yamamoto; Kato Agricultural and Biological Chemistry, 1980 , vol. 44, # 9 p. 2143 - 2147 |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |