WAY-301292 structure
|
Common Name | WAY-301292 | ||
|---|---|---|---|---|
| CAS Number | 67848-13-9 | Molecular Weight | 299.28 | |
| Density | 1.4±0.1 g/cm3 | Boiling Point | 397.7±42.0 °C at 760 mmHg | |
| Molecular Formula | C16H13NO5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 194.3±27.9 °C | |
Use of WAY-301292multi drug resistance modulators; Fungicidal; |
| Name | WAY-301292 |
|---|---|
| Synonym | More Synonyms |
| Density | 1.4±0.1 g/cm3 |
|---|---|
| Boiling Point | 397.7±42.0 °C at 760 mmHg |
| Molecular Formula | C16H13NO5 |
| Molecular Weight | 299.28 |
| Flash Point | 194.3±27.9 °C |
| Exact Mass | 299.079376 |
| LogP | 3.13 |
| Vapour Pressure | 0.0±0.9 mmHg at 25°C |
| Index of Refraction | 1.645 |
| InChIKey | BPHJTPDQSNWPMH-UHFFFAOYSA-N |
| SMILES | COC(=O)c1ccccc1NC(=O)c1ccc2c(c1)OCO2 |
| Methyl 2-[(1,3-benzodioxol-5-ylcarbonyl)amino]benzoate |
| Benzoic acid, 2-[(1,3-benzodioxol-5-ylcarbonyl)amino]-, methyl ester |