PYBG structure
|
Common Name | PYBG | ||
|---|---|---|---|---|
| CAS Number | 680622-71-3 | Molecular Weight | 309.32 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C16H15N5O2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PYBGPYBG acts as a versatile precursor to be facilely conjugated with various fluorescent dyes through ‘Click chemistry’ and Sonogashira coupling reactions[1]. |
| Name | PYBG |
|---|
| Description | PYBG acts as a versatile precursor to be facilely conjugated with various fluorescent dyes through ‘Click chemistry’ and Sonogashira coupling reactions[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C16H15N5O2 |
|---|---|
| Molecular Weight | 309.32 |
| InChIKey | LZDBKQCASZCNSH-UHFFFAOYSA-N |
| SMILES | C#CCOCc1ccc(COc2nc(N)nc3nc[nH]c23)cc1 |