PYBG-TMR structure
|
Common Name | PYBG-TMR | ||
|---|---|---|---|---|
| CAS Number | 2067339-51-7 | Molecular Weight | 693.75 | |
| Density | N/A | Boiling Point | N/A | |
| Molecular Formula | C40H35N7O5 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | N/A | |
Use of PYBG-TMRPYBG-TMR is a dye and has a role as a fluorochrome. PYBG-TMR specifically and efficiently labels the target genetically encoded SNAP-tags in live cells[1]. |
| Name | PYBG-TMR |
|---|
| Description | PYBG-TMR is a dye and has a role as a fluorochrome. PYBG-TMR specifically and efficiently labels the target genetically encoded SNAP-tags in live cells[1]. |
|---|---|
| Related Catalog | |
| References |
| Molecular Formula | C40H35N7O5 |
|---|---|
| Molecular Weight | 693.75 |
| InChIKey | RUDZHJCKRLNSJZ-UHFFFAOYSA-N |
| SMILES | CN(C)c1ccc2c(-c3cc(C#CCOCc4ccc(COc5nc(N)nc6nc[nH]c56)cc4)ccc3C(=O)[O-])c3ccc(=[N+](C)C)cc-3oc2c1 |