2,5-dichloro-4-[4,5-dihydro-3-methyl-5-oxo-4-(phenylazo)-1H-pyrazol-1-yl]benzenesulphonic acid, compound with bis(2-ethylhexyl)amine (1:1) structure
|
Common Name | 2,5-dichloro-4-[4,5-dihydro-3-methyl-5-oxo-4-(phenylazo)-1H-pyrazol-1-yl]benzenesulphonic acid, compound with bis(2-ethylhexyl)amine (1:1) | ||
|---|---|---|---|---|
| CAS Number | 68109-77-3 | Molecular Weight | 668.71800 | |
| Density | N/A | Boiling Point | 774.4ºC at 760 mmHg | |
| Molecular Formula | C32H47Cl2N5O4S | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 422.2ºC | |
| Name | 2,5-dichloro-4-(3-methyl-5-oxo-4-phenyldiazenyl-4H-pyrazol-1-yl)benzenesulfonic acid,2-ethyl-N-(2-ethylhexyl)hexan-1-amine |
|---|
| Boiling Point | 774.4ºC at 760 mmHg |
|---|---|
| Molecular Formula | C32H47Cl2N5O4S |
| Molecular Weight | 668.71800 |
| Flash Point | 422.2ºC |
| Exact Mass | 667.27300 |
| PSA | 132.17000 |
| LogP | 10.09620 |
| InChIKey | OFIATOFGJTVOBS-UHFFFAOYSA-N |
| SMILES | CC1=NN(c2cc(Cl)c(S(=O)(=O)O)cc2Cl)C(=O)C1N=Nc1ccccc1.CCCCC(CC)CNCC(CC)CCCC |