1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium salt structure
|
Common Name | 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium salt | ||
|---|---|---|---|---|
| CAS Number | 6811-55-8 | Molecular Weight | 810.02500 | |
| Density | N/A | Boiling Point | 815.9ºC at 760 mmHg | |
| Molecular Formula | C42H77NNaO10P | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 447.2ºC | |
| Name | 1,2-Dioleoyl-sn-glycero-3-phospho-L-serine sodium salt |
|---|---|
| Synonym | More Synonyms |
| Boiling Point | 815.9ºC at 760 mmHg |
|---|---|
| Molecular Formula | C42H77NNaO10P |
| Molecular Weight | 810.02500 |
| Flash Point | 447.2ºC |
| Exact Mass | 809.51800 |
| PSA | 184.32000 |
| LogP | 12.20040 |
| InChIKey | WTBFLCSPLLEDEM-FDYKVURPSA-N |
| SMILES | CCCCCCCCC=CCCCCCCCC(=O)OCC(COP(=O)(O)OCC(N)C(=O)O)OC(=O)CCCCCCCC=CCCCCCCCC |
| WGK Germany | 3 |
|---|
|
~%
1,2-Dioleoyl-sn... CAS#:6811-55-8 |
| Literature: THE BRIGHAM and WOMEN'S HOSPITAL, INC.; U.S. DEPT. OF VETERANS AFFAIRS Patent: US2007/249734 A1, 2007 ; Location in patent: Page/Page column 4 ; |
| Precursor 2 | |
|---|---|
| DownStream 0 | |
| MFCD00133436 |
| (2S)-2-amino-3-[[(2S)-2,3-di(octadec-9-enoyloxy)propoxy]-hydroxyphosphoryl]oxypropanoic acid |