3'-Hydroxybiphenyl-3-carboxamide structure
|
Common Name | 3'-Hydroxybiphenyl-3-carboxamide | ||
|---|---|---|---|---|
| CAS Number | 681161-44-4 | Molecular Weight | 213.23200 | |
| Density | 1.24g/cm3 | Boiling Point | 452.5ºC at 760 mmHg | |
| Molecular Formula | C13H11NO2 | Melting Point | N/A | |
| MSDS | N/A | Flash Point | 227.5ºC | |
| Name | 3'-Hydroxy-[1,1'-biphenyl]-3-carboxamide |
|---|---|
| Synonym | More Synonyms |
| Density | 1.24g/cm3 |
|---|---|
| Boiling Point | 452.5ºC at 760 mmHg |
| Molecular Formula | C13H11NO2 |
| Molecular Weight | 213.23200 |
| Flash Point | 227.5ºC |
| Exact Mass | 213.07900 |
| PSA | 63.32000 |
| LogP | 2.85840 |
| Index of Refraction | 1.636 |
| InChIKey | BQRRGDDGUKOPJO-UHFFFAOYSA-N |
| SMILES | NC(=O)c1cccc(-c2cccc(O)c2)c1 |
| HS Code | 2924299090 |
|---|
| HS Code | 2924299090 |
|---|---|
| Summary | 2924299090. other cyclic amides (including cyclic carbamates) and their derivatives; salts thereof. VAT:17.0%. Tax rebate rate:13.0%. . MFN tariff:6.5%. General tariff:30.0% |
| 3-(3-hydroxyphenyl)benzamide |